![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| psychopharmacology.html | 2025-12-04 13:59 | 92K | |
| img/ | 2025-11-24 17:33 | - | |
| ethics.html | 2025-11-02 14:04 | 84K | |
| research.html | 2025-11-02 13:58 | 94K | |
| eeg.html | 2025-11-02 13:33 | 444K | |
| neuroscience.html | 2025-10-30 14:05 | 632K | |
| home.html | 2025-08-01 15:28 | 8.9K | |
| technical.html | 2025-07-01 17:42 | 205K | |
| audio/ | 2025-07-01 17:05 | - | |
| history.html | 2025-07-01 14:35 | 97K | |
| signal-processing.html | 2025-07-01 12:18 | 73K | |
| signal-acquisition.html | 2025-07-01 12:16 | 69K | |
| definition.html | 2025-07-01 12:10 | 33K | |
| neurophysiology.html | 2025-07-01 12:08 | 175K | |
| neuroanatomy.html | 2025-07-01 12:06 | 245K | |
| assumptions.html | 2025-07-01 12:02 | 193K | |
| qeeg.html | 2025-05-26 04:01 | 355K | |
| clinical practice.html | 2025-05-26 03:05 | 180K | |
| medication.html | 2025-05-07 18:09 | 48K | |
| learning.html | 2025-05-07 18:08 | 40K | |
| concepts.html | 2025-05-07 18:04 | 28K | |
| aseptic-techniques.html | 2025-05-07 18:02 | 18K | |
| montages.html | 2025-02-19 02:32 | 111K | |
| aspects.html | 2025-02-19 02:32 | 219K | |
| Exerkines_ Molecular Messengers that Mediate Exercise Effects _ The Scientist Magazine®.pdf | 2025-01-09 23:43 | 6.5M | |
| home.test.html | 2023-07-07 13:27 | 8.2K | |
| efficacy-criteria.html | 2023-07-06 16:10 | 67K | |
| history test.html | 2023-07-06 15:01 | 70K | |
| database.html | 2023-05-06 17:48 | 76K | |
| css/ | 2023-01-18 00:53 | - | |
| assets/ | 2023-01-18 00:53 | - | |
| qEEG Analysis and Applications.html | 2022-10-21 03:42 | 154K | |
| recording and editing.html | 2022-10-15 01:34 | 82K | |
| artifact.html | 2022-10-09 15:35 | 54K | |
| trends.html | 2022-03-03 17:37 | 123K | |
| terms.html | 2022-02-03 19:58 | 93K | |
| key-studies.html | 2022-01-31 20:36 | 128K | |
| assessment-demonstration.html | 2021-12-09 16:44 | 7.9K | |
| early-protocols.html | 2021-05-05 15:37 | 59K | |
| intake.html | 2021-05-05 02:09 | 28K | |
| shutterstock dorsal root.html | 2016-06-30 19:24 | 38K | |
| glossary.html | 2014-12-10 19:30 | 3.6K | |
| treatment-demonstration-2.html | 2014-12-10 19:29 | 3.6K | |
| treatment-demonstration.html | 2014-12-10 19:29 | 3.6K | |
| steps.html | 2014-12-10 19:29 | 3.6K | |
| remote.html | 2014-12-10 19:29 | 3.6K | |
| relationship.html | 2014-12-10 19:29 | 3.6K | |
| procedures.html | 2014-12-10 19:29 | 3.6K | |
| page-template.html | 2014-12-10 19:28 | 3.6K | |
| ongoing.html | 2014-12-10 19:28 | 3.6K | |
| client-preparation.html | 2014-12-10 19:26 | 3.6K | |
| Legitimate Biofeedback January 2009.pdf | 2011-05-09 05:38 | 125K | |